C17H15F3N2O — CID 75404306
5,5-dicyclopropyl-3-oxo-2-[5-(trifluoromethyl)-2-pyridinyl]pent-4-enenitrile (PubChem CID 75404306) has the molecular formula C17H15F3N2O and a molecular weight of 320.31 g/mol. Its IUPAC name is 5,5-dicyclopropyl-3-oxo-2-[5-(trifluoromethyl)-2-pyridinyl]pent-4-enenitrile.
| Compound Name | 5,5-dicyclopropyl-3-oxo-2-[5-(trifluoromethyl)-2-pyridinyl]pent-4-enenitrile |
|---|---|
| PubChem CID | 75404306 |
| Molecular Formula | C17H15F3N2O |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 5,5-dicyclopropyl-3-oxo-2-[5-(trifluoromethyl)-2-pyridinyl]pent-4-enenitrile |
| SMILES | N#CC(C(=O)C=C(C1CC1)C1CC1)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C17H15F3N2O/c18-17(19,20)12-5-6-15(22-9-12)14(8-21)16(23)7-13(10-1-2-10)11-3-4-11/h5-7,9-11,14H,1-4H2 |
| InChIKey | PWGYRGCKZXXJDU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|