C17H19BrFNO — CID 75404400
N-[(5-bromo-2-fluorophenyl)methyl]-3,3-dicyclopropyl-N-methylprop-2-enamide (PubChem CID 75404400) has the molecular formula C17H19BrFNO and a molecular weight of 352.25 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-3,3-dicyclopropyl-N-methylprop-2-enamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-3,3-dicyclopropyl-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 75404400 |
| Molecular Formula | C17H19BrFNO |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-3,3-dicyclopropyl-N-methylprop-2-enamide |
| SMILES | CN(Cc1cc(Br)ccc1F)C(=O)C=C(C1CC1)C1CC1 |
| InChI | InChI=1S/C17H19BrFNO/c1-20(10-13-8-14(18)6-7-16(13)19)17(21)9-15(11-2-3-11)12-4-5-12/h6-9,11-12H,2-5,10H2,1H3 |
| InChIKey | LITZYQBCCJOLRS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|