C18H21N3O2 — CID 75405456
1-(furan-2-ylmethyl)-3-[(4-phenylcyclohexylidene)amino]urea (PubChem CID 75405456) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[(4-phenylcyclohexylidene)amino]urea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[(4-phenylcyclohexylidene)amino]urea |
|---|---|
| PubChem CID | 75405456 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[(4-phenylcyclohexylidene)amino]urea |
| SMILES | O=C(NCc1ccco1)NN=C1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H21N3O2/c22-18(19-13-17-7-4-12-23-17)21-20-16-10-8-15(9-11-16)14-5-2-1-3-6-14/h1-7,12,15H,8-11,13H2,(H2,19,21,22)/b20-16- |
| InChIKey | ITDFMNYTCNTWFT-SILNSSARSA-N |
| XLogP | 3.79 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|