C19H26N4O2 — CID 75407533
1-[(E)-3-cyclohexylprop-2-enoyl]-N-pyrimidin-2-ylpiperidine-4-carboxamide (PubChem CID 75407533) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[(E)-3-cyclohexylprop-2-enoyl]-N-pyrimidin-2-ylpiperidine-4-carboxamide.
| Compound Name | 1-[(E)-3-cyclohexylprop-2-enoyl]-N-pyrimidin-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 75407533 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 1-[(E)-3-cyclohexylprop-2-enoyl]-N-pyrimidin-2-ylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ncccn1)C1CCN(C(=O)/C=C/C2CCCCC2)CC1 |
| InChI | InChI=1S/C19H26N4O2/c24-17(8-7-15-5-2-1-3-6-15)23-13-9-16(10-14-23)18(25)22-19-20-11-4-12-21-19/h4,7-8,11-12,15-16H,1-3,5-6,9-10,13-14H2,(H,20,21,22,25)/b8-7+ |
| InChIKey | VLKITKWFWMLUSZ-BQYQJAHWSA-N |
| XLogP | 2.79 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|