C17H25N5O2 — CID 75479953
1-[3-(2-oxopyrrolidin-1-yl)propyl]-N-pyrimidin-2-ylpiperidine-4-carboxamide (PubChem CID 75479953) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-[3-(2-oxopyrrolidin-1-yl)propyl]-N-pyrimidin-2-ylpiperidine-4-carboxamide.
| Compound Name | 1-[3-(2-oxopyrrolidin-1-yl)propyl]-N-pyrimidin-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 75479953 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 1-[3-(2-oxopyrrolidin-1-yl)propyl]-N-pyrimidin-2-ylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ncccn1)C1CCN(CCCN2CCCC2=O)CC1 |
| InChI | InChI=1S/C17H25N5O2/c23-15-4-1-10-22(15)11-3-9-21-12-5-14(6-13-21)16(24)20-17-18-7-2-8-19-17/h2,7-8,14H,1,3-6,9-13H2,(H,18,19,20,24) |
| InChIKey | KIQHLCSTJURCOR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |