C21H25N3O — CID 75407691
(E)-1-(4-benzyl-2-methyl-1,4-diazepan-1-yl)-3-pyridin-4-ylprop-2-en-1-one (PubChem CID 75407691) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is (E)-1-(4-benzyl-2-methyl-1,4-diazepan-1-yl)-3-pyridin-4-ylprop-2-en-1-one.
| Compound Name | (E)-1-(4-benzyl-2-methyl-1,4-diazepan-1-yl)-3-pyridin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 75407691 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | (E)-1-(4-benzyl-2-methyl-1,4-diazepan-1-yl)-3-pyridin-4-ylprop-2-en-1-one |
| SMILES | CC1CN(Cc2ccccc2)CCCN1C(=O)/C=C/c1ccncc1 |
| InChI | InChI=1S/C21H25N3O/c1-18-16-23(17-20-6-3-2-4-7-20)14-5-15-24(18)21(25)9-8-19-10-12-22-13-11-19/h2-4,6-13,18H,5,14-17H2,1H3/b9-8+ |
| InChIKey | RHFOZEKTCMDBOH-CMDGGOBGSA-N |
| XLogP | 3.22 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|