C15H18N2O3S — CID 75408061
(Z)-N-(4-cyanophenyl)sulfonyl-3,4,4-trimethylpent-2-enamide (PubChem CID 75408061) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is (Z)-N-(4-cyanophenyl)sulfonyl-3,4,4-trimethylpent-2-enamide.
| Compound Name | (Z)-N-(4-cyanophenyl)sulfonyl-3,4,4-trimethylpent-2-enamide |
|---|---|
| PubChem CID | 75408061 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (Z)-N-(4-cyanophenyl)sulfonyl-3,4,4-trimethylpent-2-enamide |
| SMILES | C/C(=C/C(=O)NS(=O)(=O)c1ccc(C#N)cc1)C(C)(C)C |
| InChI | InChI=1S/C15H18N2O3S/c1-11(15(2,3)4)9-14(18)17-21(19,20)13-7-5-12(10-16)6-8-13/h5-9H,1-4H3,(H,17,18)/b11-9- |
| InChIKey | QGCJKTRCXNADGG-LUAWRHEFSA-N |
| XLogP | 2.36 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|