C17H23NO4S — CID 10688340
[(3E)-4,5,5-trimethylhexa-1,3-dien-2-yl] N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 10688340) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is [(3E)-4,5,5-trimethylhexa-1,3-dien-2-yl] N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | [(3E)-4,5,5-trimethylhexa-1,3-dien-2-yl] N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 10688340 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | [(3E)-4,5,5-trimethylhexa-1,3-dien-2-yl] N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | C=C(/C=C(\C)C(C)(C)C)OC(=O)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H23NO4S/c1-12-7-9-15(10-8-12)23(20,21)18-16(19)22-14(3)11-13(2)17(4,5)6/h7-11H,3H2,1-2,4-6H3,(H,18,19)/b13-11+ |
| InChIKey | LWRLOEGROUNMJJ-ACCUITESSA-N |
| XLogP | 3.92 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|