C16H24NO3S+ — CID 138980174
[(2Z,5E)-4,5-dimethyl-3-[(4-methylphenyl)sulfonylamino]hepta-2,5-dien-4-yl]oxidanium (PubChem CID 138980174) has the molecular formula C16H24NO3S+ and a molecular weight of 310.44 g/mol. Its IUPAC name is [(2Z,5E)-4,5-dimethyl-3-[(4-methylphenyl)sulfonylamino]hepta-2,5-dien-4-yl]oxidanium.
| Compound Name | [(2Z,5E)-4,5-dimethyl-3-[(4-methylphenyl)sulfonylamino]hepta-2,5-dien-4-yl]oxidanium |
|---|---|
| PubChem CID | 138980174 |
| Molecular Formula | C16H24NO3S+ |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [(2Z,5E)-4,5-dimethyl-3-[(4-methylphenyl)sulfonylamino]hepta-2,5-dien-4-yl]oxidanium |
| SMILES | C/C=C(\NS(=O)(=O)c1ccc(C)cc1)C(C)([OH2+])/C(C)=C/C |
| InChI | InChI=1S/C16H23NO3S/c1-6-13(4)16(5,18)15(7-2)17-21(19,20)14-10-8-12(3)9-11-14/h6-11,17-18H,1-5H3/p+1/b13-6+,15-7- |
| InChIKey | UZVCSKUKTRYREC-CZWUKLLNSA-O |
| XLogP | 2.63 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|