C20H26N2O2S — CID 20803157
N'-[(4-tert-butylphenyl)methyl]-N-(4-methylphenyl)sulfonylethanimidamide (PubChem CID 20803157) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is N'-[(4-tert-butylphenyl)methyl]-N-(4-methylphenyl)sulfonylethanimidamide.
| Compound Name | N'-[(4-tert-butylphenyl)methyl]-N-(4-methylphenyl)sulfonylethanimidamide |
|---|---|
| PubChem CID | 20803157 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N'-[(4-tert-butylphenyl)methyl]-N-(4-methylphenyl)sulfonylethanimidamide |
| SMILES | C/C(=N\Cc1ccc(C(C)(C)C)cc1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H26N2O2S/c1-15-6-12-19(13-7-15)25(23,24)22-16(2)21-14-17-8-10-18(11-9-17)20(3,4)5/h6-13H,14H2,1-5H3,(H,21,22) |
| InChIKey | YHMKBVRKKUEPMR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|