C13H11F3N2O2S — CID 75408174
(E)-3-(furan-2-yl)-N-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]prop-2-enamide (PubChem CID 75408174) has the molecular formula C13H11F3N2O2S and a molecular weight of 316.30 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 75408174 |
| Molecular Formula | C13H11F3N2O2S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]prop-2-enamide |
| SMILES | CN(Cc1nc(C(F)(F)F)cs1)C(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C13H11F3N2O2S/c1-18(12(19)5-4-9-3-2-6-20-9)7-11-17-10(8-21-11)13(14,15)16/h2-6,8H,7H2,1H3/b5-4+ |
| InChIKey | JUEHOHHXYCIQJL-SNAWJCMRSA-N |
| XLogP | 3.43 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|