C14H17FN2O4 — CID 75410391
2-[(3S,4R)-1-acetyl-4-fluoropyrrolidin-3-yl]oxy-N-(2-hydroxyphenyl)acetamide (PubChem CID 75410391) has the molecular formula C14H17FN2O4 and a molecular weight of 296.30 g/mol. Its IUPAC name is 2-[(3S,4R)-1-acetyl-4-fluoropyrrolidin-3-yl]oxy-N-(2-hydroxyphenyl)acetamide.
| Compound Name | 2-[(3S,4R)-1-acetyl-4-fluoropyrrolidin-3-yl]oxy-N-(2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 75410391 |
| Molecular Formula | C14H17FN2O4 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-[(3S,4R)-1-acetyl-4-fluoropyrrolidin-3-yl]oxy-N-(2-hydroxyphenyl)acetamide |
| SMILES | CC(=O)N1C[C@@H](F)[C@@H](OCC(=O)Nc2ccccc2O)C1 |
| InChI | InChI=1S/C14H17FN2O4/c1-9(18)17-6-10(15)13(7-17)21-8-14(20)16-11-4-2-3-5-12(11)19/h2-5,10,13,19H,6-8H2,1H3,(H,16,20)/t10-,13+/m1/s1 |
| InChIKey | CBTUMQOIBNRBNC-MFKMUULPSA-N |
| XLogP | 0.92 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|