C17H20N2O4 — CID 4500800
2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)-N-(2-hydroxyphenyl)acetamide (PubChem CID 4500800) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)-N-(2-hydroxyphenyl)acetamide.
| Compound Name | 2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)-N-(2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 4500800 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)-N-(2-hydroxyphenyl)acetamide |
| SMILES | O=C(CN1C(=O)CC2(CCCC2)CC1=O)Nc1ccccc1O |
| InChI | InChI=1S/C17H20N2O4/c20-13-6-2-1-5-12(13)18-14(21)11-19-15(22)9-17(10-16(19)23)7-3-4-8-17/h1-2,5-6,20H,3-4,7-11H2,(H,18,21) |
| InChIKey | BLOXQKZDUJJYKQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|