About 3-iodoimidazo[1,2-a]pyrimidine
3-iodoimidazo[1,2-a]pyrimidine (PubChem CID 75412176) has the molecular formula C6H4IN3
and a molecular weight of 245.02 g/mol. Its IUPAC name is 3-iodoimidazo[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | 3-iodoimidazo[1,2-a]pyrimidine |
| PubChem CID | 75412176 |
| Molecular Formula | C6H4IN3 |
| Molecular Weight | 245.02 g/mol |
| Exact Mass | 244.94 |
| IUPAC Name | 3-iodoimidazo[1,2-a]pyrimidine |
| SMILES | Ic1cnc2ncccn12 |
| InChI | InChI=1S/C6H4IN3/c7-5-4-9-6-8-2-1-3-10(5)6/h1-4H |
| InChIKey | HYNDIQDXMQWEFY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.02 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodoimidazo[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodoimidazo[1,2-a]pyrimidine?
The IUPAC name of 3-iodoimidazo[1,2-a]pyrimidine (CID 75412176) is 3-iodoimidazo[1,2-a]pyrimidine.
What is the SMILES notation for 3-iodoimidazo[1,2-a]pyrimidine?
The canonical SMILES for 3-iodoimidazo[1,2-a]pyrimidine is Ic1cnc2ncccn12.
What is the InChIKey of 3-iodoimidazo[1,2-a]pyrimidine?
The InChIKey is HYNDIQDXMQWEFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4IN3/c7-5-4-9-6-8-2-1-3-10(5)6/h1-4H.
What are the key properties of 3-iodoimidazo[1,2-a]pyrimidine?
3-iodoimidazo[1,2-a]pyrimidine has a molecular weight of 245.02 g/mol, XLogP of 1.33, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodoimidazo[1,2-a]pyrimidine is sourced from PubChem (CID 75412176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).