C10H20N2OS2 — CID 75412864
3-hydroxy-N-(3-methylsulfanylpropyl)piperidine-1-carbothioamide (PubChem CID 75412864) has the molecular formula C10H20N2OS2 and a molecular weight of 248.42 g/mol. Its IUPAC name is 3-hydroxy-N-(3-methylsulfanylpropyl)piperidine-1-carbothioamide.
| Compound Name | 3-hydroxy-N-(3-methylsulfanylpropyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 75412864 |
| Molecular Formula | C10H20N2OS2 |
| Molecular Weight | 248.42 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-hydroxy-N-(3-methylsulfanylpropyl)piperidine-1-carbothioamide |
| SMILES | CSCCCNC(=S)N1CCCC(O)C1 |
| InChI | InChI=1S/C10H20N2OS2/c1-15-7-3-5-11-10(14)12-6-2-4-9(13)8-12/h9,13H,2-8H2,1H3,(H,11,14) |
| InChIKey | RNGQXTWFDUILEN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.42 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|