C14H14N2O2S — CID 75416759
prop-2-ynyl 2-[2-(2,5-dimethylpyrrol-1-yl)-1,3-thiazol-4-yl]acetate (PubChem CID 75416759) has the molecular formula C14H14N2O2S and a molecular weight of 274.34 g/mol. Its IUPAC name is prop-2-ynyl 2-[2-(2,5-dimethylpyrrol-1-yl)-1,3-thiazol-4-yl]acetate.
| Compound Name | prop-2-ynyl 2-[2-(2,5-dimethylpyrrol-1-yl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 75416759 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | prop-2-ynyl 2-[2-(2,5-dimethylpyrrol-1-yl)-1,3-thiazol-4-yl]acetate |
| SMILES | C#CCOC(=O)Cc1csc(-n2c(C)ccc2C)n1 |
| InChI | InChI=1S/C14H14N2O2S/c1-4-7-18-13(17)8-12-9-19-14(15-12)16-10(2)5-6-11(16)3/h1,5-6,9H,7-8H2,2-3H3 |
| InChIKey | OUVCVOBTOYNFLB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|