C14H12BrNO4 — CID 75417900
3-(4-bromophenyl)-3-(furan-3-carbonylamino)propanoic acid (PubChem CID 75417900) has the molecular formula C14H12BrNO4 and a molecular weight of 338.16 g/mol. Its IUPAC name is 3-(4-bromophenyl)-3-(furan-3-carbonylamino)propanoic acid.
| Compound Name | 3-(4-bromophenyl)-3-(furan-3-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 75417900 |
| Molecular Formula | C14H12BrNO4 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 3-(4-bromophenyl)-3-(furan-3-carbonylamino)propanoic acid |
| SMILES | O=C(O)CC(NC(=O)c1ccoc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H12BrNO4/c15-11-3-1-9(2-4-11)12(7-13(17)18)16-14(19)10-5-6-20-8-10/h1-6,8,12H,7H2,(H,16,19)(H,17,18) |
| InChIKey | LCTYMJHKVSUYKN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |