C14H11N3O3 — CID 75418529
6-oxo-N-(3-oxo-1,2-dihydroisoindol-5-yl)-1H-pyridine-3-carboxamide (PubChem CID 75418529) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is 6-oxo-N-(3-oxo-1,2-dihydroisoindol-5-yl)-1H-pyridine-3-carboxamide.
| Compound Name | 6-oxo-N-(3-oxo-1,2-dihydroisoindol-5-yl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 75418529 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 6-oxo-N-(3-oxo-1,2-dihydroisoindol-5-yl)-1H-pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)NC2)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C14H11N3O3/c18-12-4-2-9(7-15-12)13(19)17-10-3-1-8-6-16-14(20)11(8)5-10/h1-5,7H,6H2,(H,15,18)(H,16,20)(H,17,19) |
| InChIKey | UBOTWELYXGUYOO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |