C18H21FN2O3S2 — CID 75419057
N-(2-fluorophenyl)-N-methyl-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide (PubChem CID 75419057) has the molecular formula C18H21FN2O3S2 and a molecular weight of 396.51 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N-methyl-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-(2-fluorophenyl)-N-methyl-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 75419057 |
| Molecular Formula | C18H21FN2O3S2 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-(2-fluorophenyl)-N-methyl-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(C(=O)N(C)c3ccccc3F)C2)s1 |
| InChI | InChI=1S/C18H21FN2O3S2/c1-13-9-10-17(25-13)26(23,24)21-11-5-6-14(12-21)18(22)20(2)16-8-4-3-7-15(16)19/h3-4,7-10,14H,5-6,11-12H2,1-2H3 |
| InChIKey | GPEWSKNMOICHEY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |