C23H24N4O4S — CID 75419257
N-[4-(4-methylsulfonylphenoxy)phenyl]-1-pyrimidin-2-ylpiperidine-4-carboxamide (PubChem CID 75419257) has the molecular formula C23H24N4O4S and a molecular weight of 452.54 g/mol. Its IUPAC name is N-[4-(4-methylsulfonylphenoxy)phenyl]-1-pyrimidin-2-ylpiperidine-4-carboxamide.
| Compound Name | N-[4-(4-methylsulfonylphenoxy)phenyl]-1-pyrimidin-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 75419257 |
| Molecular Formula | C23H24N4O4S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | N-[4-(4-methylsulfonylphenoxy)phenyl]-1-pyrimidin-2-ylpiperidine-4-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(Oc2ccc(NC(=O)C3CCN(c4ncccn4)CC3)cc2)cc1 |
| InChI | InChI=1S/C23H24N4O4S/c1-32(29,30)21-9-7-20(8-10-21)31-19-5-3-18(4-6-19)26-22(28)17-11-15-27(16-12-17)23-24-13-2-14-25-23/h2-10,13-14,17H,11-12,15-16H2,1H3,(H,26,28) |
| InChIKey | XVOPPLIJIGARBR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |