C15H21N3O2 — CID 75421199
1-[2-(4-methoxyphenoxy)ethyl]-1,2-dimethyl-3-prop-2-ynylguanidine (PubChem CID 75421199) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenoxy)ethyl]-1,2-dimethyl-3-prop-2-ynylguanidine.
| Compound Name | 1-[2-(4-methoxyphenoxy)ethyl]-1,2-dimethyl-3-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 75421199 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 1-[2-(4-methoxyphenoxy)ethyl]-1,2-dimethyl-3-prop-2-ynylguanidine |
| SMILES | C#CCN/C(=N\C)N(C)CCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C15H21N3O2/c1-5-10-17-15(16-2)18(3)11-12-20-14-8-6-13(19-4)7-9-14/h1,6-9H,10-12H2,2-4H3,(H,16,17) |
| InChIKey | MBFPIURTHDSTQK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|