C11H12BrN3S — CID 75421859
5-bromo-N-[3-(1,3-thiazol-2-yl)propyl]pyridin-2-amine (PubChem CID 75421859) has the molecular formula C11H12BrN3S and a molecular weight of 298.21 g/mol. Its IUPAC name is 5-bromo-N-[3-(1,3-thiazol-2-yl)propyl]pyridin-2-amine.
| Compound Name | 5-bromo-N-[3-(1,3-thiazol-2-yl)propyl]pyridin-2-amine |
|---|---|
| PubChem CID | 75421859 |
| Molecular Formula | C11H12BrN3S |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 5-bromo-N-[3-(1,3-thiazol-2-yl)propyl]pyridin-2-amine |
| SMILES | Brc1ccc(NCCCc2nccs2)nc1 |
| InChI | InChI=1S/C11H12BrN3S/c12-9-3-4-10(15-8-9)13-5-1-2-11-14-6-7-16-11/h3-4,6-8H,1-2,5H2,(H,13,15) |
| InChIKey | FHADJYYITALLEG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|