C8H11BrN2O3S — CID 174853714
3-[(5-bromo-2-pyridinyl)amino]propyl hydrogen sulfite (PubChem CID 174853714) has the molecular formula C8H11BrN2O3S and a molecular weight of 295.16 g/mol. Its IUPAC name is 3-[(5-bromo-2-pyridinyl)amino]propyl hydrogen sulfite.
| Compound Name | 3-[(5-bromo-2-pyridinyl)amino]propyl hydrogen sulfite |
|---|---|
| PubChem CID | 174853714 |
| Molecular Formula | C8H11BrN2O3S |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | 3-[(5-bromo-2-pyridinyl)amino]propyl hydrogen sulfite |
| SMILES | O=S(O)OCCCNc1ccc(Br)cn1 |
| InChI | InChI=1S/C8H11BrN2O3S/c9-7-2-3-8(11-6-7)10-4-1-5-14-15(12)13/h2-3,6H,1,4-5H2,(H,10,11)(H,12,13) |
| InChIKey | CCHWEGSYMKQSNV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|