C12H16F3N5OS — CID 75421888
N-(2-prop-2-enylsulfanylethyl)-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxamide (PubChem CID 75421888) has the molecular formula C12H16F3N5OS and a molecular weight of 335.36 g/mol. Its IUPAC name is N-(2-prop-2-enylsulfanylethyl)-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxamide.
| Compound Name | N-(2-prop-2-enylsulfanylethyl)-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 75421888 |
| Molecular Formula | C12H16F3N5OS |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | N-(2-prop-2-enylsulfanylethyl)-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxamide |
| SMILES | C=CCSCCNC(=O)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C12H16F3N5OS/c1-2-6-22-7-3-16-11(21)19-4-5-20-9(8-19)17-18-10(20)12(13,14)15/h2H,1,3-8H2,(H,16,21) |
| InChIKey | BSTVLSLEUPHXSU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|