C14H17NO3S2 — CID 75421892
N-(2-hydroxyethyl)-1-phenyl-N-(thiophen-3-ylmethyl)methanesulfonamide (PubChem CID 75421892) has the molecular formula C14H17NO3S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-1-phenyl-N-(thiophen-3-ylmethyl)methanesulfonamide.
| Compound Name | N-(2-hydroxyethyl)-1-phenyl-N-(thiophen-3-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 75421892 |
| Molecular Formula | C14H17NO3S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | N-(2-hydroxyethyl)-1-phenyl-N-(thiophen-3-ylmethyl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)N(CCO)Cc1ccsc1 |
| InChI | InChI=1S/C14H17NO3S2/c16-8-7-15(10-14-6-9-19-11-14)20(17,18)12-13-4-2-1-3-5-13/h1-6,9,11,16H,7-8,10,12H2 |
| InChIKey | HCPKDYNGEATORN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |