C6H8ClF3N4 — CID 75422064
1-(2,2,2-trifluoroethyl)pyrazole-4-carboximidamide;hydrochloride (PubChem CID 75422064) has the molecular formula C6H8ClF3N4 and a molecular weight of 228.61 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)pyrazole-4-carboximidamide;hydrochloride.
| Compound Name | 1-(2,2,2-trifluoroethyl)pyrazole-4-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 75422064 |
| Molecular Formula | C6H8ClF3N4 |
| Molecular Weight | 228.61 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)pyrazole-4-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1cnn(CC(F)(F)F)c1 |
| InChI | InChI=1S/C6H7F3N4.ClH/c7-6(8,9)3-13-2-4(1-12-13)5(10)11;/h1-2H,3H2,(H3,10,11);1H |
| InChIKey | ZWKXRFSYUDWPKO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.61 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|