C25H31F4N5O — CID 160945827
4-amino-3-[3-[(4-fluoro-4-methylcyclohexyl)methylamino]-4-[1-(2,2,2-trifluoroethyl)pyrazole-4-carboximidoyl]phenyl]pent-3-en-2-one (PubChem CID 160945827) has the molecular formula C25H31F4N5O and a molecular weight of 493.55 g/mol. Its IUPAC name is 4-amino-3-[3-[(4-fluoro-4-methylcyclohexyl)methylamino]-4-[1-(2,2,2-trifluoroethyl)pyrazole-4-carboximidoyl]phenyl]pent-3-en-2-one.
| Compound Name | 4-amino-3-[3-[(4-fluoro-4-methylcyclohexyl)methylamino]-4-[1-(2,2,2-trifluoroethyl)pyrazole-4-carboximidoyl]phenyl]pent-3-en-2-one |
|---|---|
| PubChem CID | 160945827 |
| Molecular Formula | C25H31F4N5O |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | 4-amino-3-[3-[(4-fluoro-4-methylcyclohexyl)methylamino]-4-[1-(2,2,2-trifluoroethyl)pyrazole-4-carboximidoyl]phenyl]pent-3-en-2-one |
| SMILES | [H]/N=C(\c1cnn(CC(F)(F)F)c1)c1ccc(C(C(C)=O)=C(C)N)cc1NCC1CCC(C)(F)CC1 |
| InChI | InChI=1S/C25H31F4N5O/c1-15(30)22(16(2)35)18-4-5-20(23(31)19-12-33-34(13-19)14-25(27,28)29)21(10-18)32-11-17-6-8-24(3,26)9-7-17/h4-5,10,12-13,17,31-32H,6-9,11,14,30H2,1-3H3/b22-15?,31-23+ |
| InChIKey | QMUISVICKLFGGC-TUQBPQOQSA-N |
| XLogP | 5.47 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|