C17H22FN3O3 — CID 75426016
1-(4-fluoro-3-pyrrol-1-ylphenyl)-3-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)urea (PubChem CID 75426016) has the molecular formula C17H22FN3O3 and a molecular weight of 335.38 g/mol. Its IUPAC name is 1-(4-fluoro-3-pyrrol-1-ylphenyl)-3-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)urea.
| Compound Name | 1-(4-fluoro-3-pyrrol-1-ylphenyl)-3-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)urea |
|---|---|
| PubChem CID | 75426016 |
| Molecular Formula | C17H22FN3O3 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-(4-fluoro-3-pyrrol-1-ylphenyl)-3-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)urea |
| SMILES | COCC(C)(CCO)NC(=O)Nc1ccc(F)c(-n2cccc2)c1 |
| InChI | InChI=1S/C17H22FN3O3/c1-17(7-10-22,12-24-2)20-16(23)19-13-5-6-14(18)15(11-13)21-8-3-4-9-21/h3-6,8-9,11,22H,7,10,12H2,1-2H3,(H2,19,20,23) |
| InChIKey | IEMHMWYXLGAFPD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |