C13H18ClFN2O3 — CID 111967704
1-(2-chloro-4-fluorophenyl)-3-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)urea (PubChem CID 111967704) has the molecular formula C13H18ClFN2O3 and a molecular weight of 304.75 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)-3-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)urea.
| Compound Name | 1-(2-chloro-4-fluorophenyl)-3-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)urea |
|---|---|
| PubChem CID | 111967704 |
| Molecular Formula | C13H18ClFN2O3 |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)-3-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)urea |
| SMILES | COCC(C)(CCO)NC(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C13H18ClFN2O3/c1-13(5-6-18,8-20-2)17-12(19)16-11-4-3-9(15)7-10(11)14/h3-4,7,18H,5-6,8H2,1-2H3,(H2,16,17,19) |
| InChIKey | GJYUXNYJAOWEPV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |