C18H21FN4O2 — CID 75426436
2-[[4-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]piperazin-1-yl]methyl]-4-fluorobenzonitrile (PubChem CID 75426436) has the molecular formula C18H21FN4O2 and a molecular weight of 344.39 g/mol. Its IUPAC name is 2-[[4-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]piperazin-1-yl]methyl]-4-fluorobenzonitrile.
| Compound Name | 2-[[4-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]piperazin-1-yl]methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 75426436 |
| Molecular Formula | C18H21FN4O2 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-[[4-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]piperazin-1-yl]methyl]-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)cc1CN1CCN(CCN2C(=O)CCC2=O)CC1 |
| InChI | InChI=1S/C18H21FN4O2/c19-16-2-1-14(12-20)15(11-16)13-22-7-5-21(6-8-22)9-10-23-17(24)3-4-18(23)25/h1-2,11H,3-10,13H2 |
| InChIKey | RPMWNSXZRXCZCW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 67.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|