C14H14FN3O2 — CID 107902993
2-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]-4-fluorobenzonitrile (PubChem CID 107902993) has the molecular formula C14H14FN3O2 and a molecular weight of 275.28 g/mol. Its IUPAC name is 2-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]-4-fluorobenzonitrile.
| Compound Name | 2-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 107902993 |
| Molecular Formula | C14H14FN3O2 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]-4-fluorobenzonitrile |
| SMILES | CCN1CCN(Cc2cc(F)ccc2C#N)C(=O)C1=O |
| InChI | InChI=1S/C14H14FN3O2/c1-2-17-5-6-18(14(20)13(17)19)9-11-7-12(15)4-3-10(11)8-16/h3-4,7H,2,5-6,9H2,1H3 |
| InChIKey | RGUXHDWZCJEHAN-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|