C15H16FN3O2 — CID 107909174
2-[(5,5-diethyl-2,4-dioxoimidazolidin-1-yl)methyl]-4-fluorobenzonitrile (PubChem CID 107909174) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is 2-[(5,5-diethyl-2,4-dioxoimidazolidin-1-yl)methyl]-4-fluorobenzonitrile.
| Compound Name | 2-[(5,5-diethyl-2,4-dioxoimidazolidin-1-yl)methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 107909174 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-[(5,5-diethyl-2,4-dioxoimidazolidin-1-yl)methyl]-4-fluorobenzonitrile |
| SMILES | CCC1(CC)C(=O)NC(=O)N1Cc1cc(F)ccc1C#N |
| InChI | InChI=1S/C15H16FN3O2/c1-3-15(4-2)13(20)18-14(21)19(15)9-11-7-12(16)6-5-10(11)8-17/h5-7H,3-4,9H2,1-2H3,(H,18,20,21) |
| InChIKey | LHTIHCFHHLKGJA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|