About 2-[(5,5-diethyl-2,4-dioxoimidazolidin-1-yl)methyl]-4-fluorobenzonitrile
2-[(5,5-diethyl-2,4-dioxoimidazolidin-1-yl)methyl]-4-fluorobenzonitrile (PubChem CID 107909174) has the molecular formula C15H16FN3O2
and a molecular weight of 289.31 g/mol. Its IUPAC name is 2-[(5,5-diethyl-2,4-dioxoimidazolidin-1-yl)methyl]-4-fluorobenzonitrile.
Molecular Properties
| Compound Name | 2-[(5,5-diethyl-2,4-dioxoimidazolidin-1-yl)methyl]-4-fluorobenzonitrile |
| PubChem CID | 107909174 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-[(5,5-diethyl-2,4-dioxoimidazolidin-1-yl)methyl]-4-fluorobenzonitrile |
| SMILES | CCC1(CC)C(=O)NC(=O)N1Cc1cc(F)ccc1C#N |
| InChI | InChI=1S/C15H16FN3O2/c1-3-15(4-2)13(20)18-14(21)19(15)9-11-7-12(16)6-5-10(11)8-17/h5-7H,3-4,9H2,1-2H3,(H,18,20,21) |
| InChIKey | LHTIHCFHHLKGJA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5,5-diethyl-2,4-dioxoimidazolidin-1-yl)methyl]-4-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5,5-diethyl-2,4-dioxoimidazolidin-1-yl)methyl]-4-fluorobenzonitrile?
The IUPAC name of 2-[(5,5-diethyl-2,4-dioxoimidazolidin-1-yl)methyl]-4-fluorobenzonitrile (CID 107909174) is 2-[(5,5-diethyl-2,4-dioxoimidazolidin-1-yl)methyl]-4-fluorobenzonitrile.
What is the SMILES notation for 2-[(5,5-diethyl-2,4-dioxoimidazolidin-1-yl)methyl]-4-fluorobenzonitrile?
The canonical SMILES for 2-[(5,5-diethyl-2,4-dioxoimidazolidin-1-yl)methyl]-4-fluorobenzonitrile is CCC1(CC)C(=O)NC(=O)N1Cc1cc(F)ccc1C#N.
What is the InChIKey of 2-[(5,5-diethyl-2,4-dioxoimidazolidin-1-yl)methyl]-4-fluorobenzonitrile?
The InChIKey is LHTIHCFHHLKGJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16FN3O2/c1-3-15(4-2)13(20)18-14(21)19(15)9-11-7-12(16)6-5-10(11)8-17/h5-7H,3-4,9H2,1-2H3,(H,18,20,21).
What are the key properties of 2-[(5,5-diethyl-2,4-dioxoimidazolidin-1-yl)methyl]-4-fluorobenzonitrile?
2-[(5,5-diethyl-2,4-dioxoimidazolidin-1-yl)methyl]-4-fluorobenzonitrile has a molecular weight of 289.31 g/mol, XLogP of 2.31, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5,5-diethyl-2,4-dioxoimidazolidin-1-yl)methyl]-4-fluorobenzonitrile is sourced from PubChem (CID 107909174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).