C12H8FN3O2 — CID 114014242
2-[(3,6-dioxo-1H-pyridazin-2-yl)methyl]-4-fluorobenzonitrile (PubChem CID 114014242) has the molecular formula C12H8FN3O2 and a molecular weight of 245.21 g/mol. Its IUPAC name is 2-[(3,6-dioxo-1H-pyridazin-2-yl)methyl]-4-fluorobenzonitrile.
| Compound Name | 2-[(3,6-dioxo-1H-pyridazin-2-yl)methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 114014242 |
| Molecular Formula | C12H8FN3O2 |
| Molecular Weight | 245.21 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 2-[(3,6-dioxo-1H-pyridazin-2-yl)methyl]-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)cc1Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C12H8FN3O2/c13-10-2-1-8(6-14)9(5-10)7-16-12(18)4-3-11(17)15-16/h1-5H,7H2,(H,15,17) |
| InChIKey | LGLZGHFLDCCFAZ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |