C14H14FN3O2 — CID 107907323
2-[(3,3-dimethyl-2,6-dioxopiperazin-1-yl)methyl]-4-fluorobenzonitrile (PubChem CID 107907323) has the molecular formula C14H14FN3O2 and a molecular weight of 275.28 g/mol. Its IUPAC name is 2-[(3,3-dimethyl-2,6-dioxopiperazin-1-yl)methyl]-4-fluorobenzonitrile.
| Compound Name | 2-[(3,3-dimethyl-2,6-dioxopiperazin-1-yl)methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 107907323 |
| Molecular Formula | C14H14FN3O2 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-[(3,3-dimethyl-2,6-dioxopiperazin-1-yl)methyl]-4-fluorobenzonitrile |
| SMILES | CC1(C)NCC(=O)N(Cc2cc(F)ccc2C#N)C1=O |
| InChI | InChI=1S/C14H14FN3O2/c1-14(2)13(20)18(12(19)7-17-14)8-10-5-11(15)4-3-9(10)6-16/h3-5,17H,7-8H2,1-2H3 |
| InChIKey | GJRSQCGFMQHBDN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|