C12H19N3O3 — CID 75426549
methyl (6R)-6-methyl-4-[(1-methylpyrazol-4-yl)methyl]morpholine-2-carboxylate (PubChem CID 75426549) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is methyl (6R)-6-methyl-4-[(1-methylpyrazol-4-yl)methyl]morpholine-2-carboxylate.
| Compound Name | methyl (6R)-6-methyl-4-[(1-methylpyrazol-4-yl)methyl]morpholine-2-carboxylate |
|---|---|
| PubChem CID | 75426549 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | methyl (6R)-6-methyl-4-[(1-methylpyrazol-4-yl)methyl]morpholine-2-carboxylate |
| SMILES | COC(=O)C1CN(Cc2cnn(C)c2)C[C@@H](C)O1 |
| InChI | InChI=1S/C12H19N3O3/c1-9-5-15(7-10-4-13-14(2)6-10)8-11(18-9)12(16)17-3/h4,6,9,11H,5,7-8H2,1-3H3/t9-,11?/m1/s1 |
| InChIKey | RJKABVYFYGFKPE-BFHBGLAWSA-N |
| XLogP | 0.18 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |