C11H19NO3 — CID 97064900
methyl (2R,6R)-4-but-3-enyl-6-methylmorpholine-2-carboxylate (PubChem CID 97064900) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is methyl (2R,6R)-4-but-3-enyl-6-methylmorpholine-2-carboxylate.
| Compound Name | methyl (2R,6R)-4-but-3-enyl-6-methylmorpholine-2-carboxylate |
|---|---|
| PubChem CID | 97064900 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | methyl (2R,6R)-4-but-3-enyl-6-methylmorpholine-2-carboxylate |
| SMILES | C=CCCN1C[C@@H](C)O[C@@H](C(=O)OC)C1 |
| InChI | InChI=1S/C11H19NO3/c1-4-5-6-12-7-9(2)15-10(8-12)11(13)14-3/h4,9-10H,1,5-8H2,2-3H3/t9-,10-/m1/s1 |
| InChIKey | UZVHGVPDPQOXIL-NXEZZACHSA-N |
| XLogP | 0.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|