C14H25NO3 — CID 124735104
methyl (2R,6R)-6-methyl-4-[(2R,3S)-3-methylhex-5-en-2-yl]morpholine-2-carboxylate (PubChem CID 124735104) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is methyl (2R,6R)-6-methyl-4-[(2R,3S)-3-methylhex-5-en-2-yl]morpholine-2-carboxylate.
| Compound Name | methyl (2R,6R)-6-methyl-4-[(2R,3S)-3-methylhex-5-en-2-yl]morpholine-2-carboxylate |
|---|---|
| PubChem CID | 124735104 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | methyl (2R,6R)-6-methyl-4-[(2R,3S)-3-methylhex-5-en-2-yl]morpholine-2-carboxylate |
| SMILES | C=CC[C@H](C)[C@@H](C)N1C[C@@H](C)O[C@@H](C(=O)OC)C1 |
| InChI | InChI=1S/C14H25NO3/c1-6-7-10(2)12(4)15-8-11(3)18-13(9-15)14(16)17-5/h6,10-13H,1,7-9H2,2-5H3/t10-,11+,12+,13+/m0/s1 |
| InChIKey | NBJQJOUXAGRQAY-UMSGYPCISA-N |
| XLogP | 1.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|