C14H14ClNO3S2 — CID 75427231
2-(2-chlorophenyl)sulfonyl-N-[(5-methylthiophen-2-yl)methyl]acetamide (PubChem CID 75427231) has the molecular formula C14H14ClNO3S2 and a molecular weight of 343.86 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfonyl-N-[(5-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | 2-(2-chlorophenyl)sulfonyl-N-[(5-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 75427231 |
| Molecular Formula | C14H14ClNO3S2 |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 2-(2-chlorophenyl)sulfonyl-N-[(5-methylthiophen-2-yl)methyl]acetamide |
| SMILES | Cc1ccc(CNC(=O)CS(=O)(=O)c2ccccc2Cl)s1 |
| InChI | InChI=1S/C14H14ClNO3S2/c1-10-6-7-11(20-10)8-16-14(17)9-21(18,19)13-5-3-2-4-12(13)15/h2-7H,8-9H2,1H3,(H,16,17) |
| InChIKey | HYGANPFNKHQDMM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |