C20H32N2OS — CID 75427884
[4-(1-tert-butylsulfanylpropan-2-ylamino)piperidin-1-yl]-(4-methylphenyl)methanone (PubChem CID 75427884) has the molecular formula C20H32N2OS and a molecular weight of 348.56 g/mol. Its IUPAC name is [4-(1-tert-butylsulfanylpropan-2-ylamino)piperidin-1-yl]-(4-methylphenyl)methanone.
| Compound Name | [4-(1-tert-butylsulfanylpropan-2-ylamino)piperidin-1-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 75427884 |
| Molecular Formula | C20H32N2OS |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | [4-(1-tert-butylsulfanylpropan-2-ylamino)piperidin-1-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCC(NC(C)CSC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H32N2OS/c1-15-6-8-17(9-7-15)19(23)22-12-10-18(11-13-22)21-16(2)14-24-20(3,4)5/h6-9,16,18,21H,10-14H2,1-5H3 |
| InChIKey | ZMGDVAVTUYFAKM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |