About N-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)methyl]-1-pyrazin-2-ylethanamine
N-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)methyl]-1-pyrazin-2-ylethanamine (PubChem CID 75428498) has the molecular formula C17H23N3S
and a molecular weight of 301.46 g/mol. Its IUPAC name is N-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)methyl]-1-pyrazin-2-ylethanamine.
Molecular Properties
| Compound Name | N-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)methyl]-1-pyrazin-2-ylethanamine |
| PubChem CID | 75428498 |
| Molecular Formula | C17H23N3S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | N-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)methyl]-1-pyrazin-2-ylethanamine |
| SMILES | CC(NCc1cc2c(s1)CCC(C)(C)C2)c1cnccn1 |
| InChI | InChI=1S/C17H23N3S/c1-12(15-11-18-6-7-19-15)20-10-14-8-13-9-17(2,3)5-4-16(13)21-14/h6-8,11-12,20H,4-5,9-10H2,1-3H3 |
| InChIKey | JVQKKPCHVCCMGD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)methyl]-1-pyrazin-2-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)methyl]-1-pyrazin-2-ylethanamine?
The IUPAC name of N-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)methyl]-1-pyrazin-2-ylethanamine (CID 75428498) is N-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)methyl]-1-pyrazin-2-ylethanamine.
What is the SMILES notation for N-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)methyl]-1-pyrazin-2-ylethanamine?
The canonical SMILES for N-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)methyl]-1-pyrazin-2-ylethanamine is CC(NCc1cc2c(s1)CCC(C)(C)C2)c1cnccn1.
What is the InChIKey of N-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)methyl]-1-pyrazin-2-ylethanamine?
The InChIKey is JVQKKPCHVCCMGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3S/c1-12(15-11-18-6-7-19-15)20-10-14-8-13-9-17(2,3)5-4-16(13)21-14/h6-8,11-12,20H,4-5,9-10H2,1-3H3.
What are the key properties of N-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)methyl]-1-pyrazin-2-ylethanamine?
N-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)methyl]-1-pyrazin-2-ylethanamine has a molecular weight of 301.46 g/mol, XLogP of 3.90, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)methyl]-1-pyrazin-2-ylethanamine is sourced from PubChem (CID 75428498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).