C19H25N3O — CID 75428647
N-[(2-cyclopentyloxy-4-methylphenyl)methyl]-1-pyrazin-2-ylethanamine (PubChem CID 75428647) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is N-[(2-cyclopentyloxy-4-methylphenyl)methyl]-1-pyrazin-2-ylethanamine.
| Compound Name | N-[(2-cyclopentyloxy-4-methylphenyl)methyl]-1-pyrazin-2-ylethanamine |
|---|---|
| PubChem CID | 75428647 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-[(2-cyclopentyloxy-4-methylphenyl)methyl]-1-pyrazin-2-ylethanamine |
| SMILES | Cc1ccc(CNC(C)c2cnccn2)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C19H25N3O/c1-14-7-8-16(19(11-14)23-17-5-3-4-6-17)12-22-15(2)18-13-20-9-10-21-18/h7-11,13,15,17,22H,3-6,12H2,1-2H3 |
| InChIKey | WHIYTPDKNHIEHK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |