C14H21N3O2S — CID 75431530
N-cyclopropyl-1-(1-pyridin-2-ylethyl)pyrrolidine-3-sulfonamide (PubChem CID 75431530) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is N-cyclopropyl-1-(1-pyridin-2-ylethyl)pyrrolidine-3-sulfonamide.
| Compound Name | N-cyclopropyl-1-(1-pyridin-2-ylethyl)pyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 75431530 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-cyclopropyl-1-(1-pyridin-2-ylethyl)pyrrolidine-3-sulfonamide |
| SMILES | CC(c1ccccn1)N1CCC(S(=O)(=O)NC2CC2)C1 |
| InChI | InChI=1S/C14H21N3O2S/c1-11(14-4-2-3-8-15-14)17-9-7-13(10-17)20(18,19)16-12-5-6-12/h2-4,8,11-13,16H,5-7,9-10H2,1H3 |
| InChIKey | AWDYBHQWZGTUJP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |