C16H18ClN3 — CID 91126376
2-chloro-5-[(3R)-1-[(1S)-1-pyridin-2-ylethyl]pyrrolidin-3-yl]pyridine (PubChem CID 91126376) has the molecular formula C16H18ClN3 and a molecular weight of 287.79 g/mol. Its IUPAC name is 2-chloro-5-[(3R)-1-[(1S)-1-pyridin-2-ylethyl]pyrrolidin-3-yl]pyridine.
| Compound Name | 2-chloro-5-[(3R)-1-[(1S)-1-pyridin-2-ylethyl]pyrrolidin-3-yl]pyridine |
|---|---|
| PubChem CID | 91126376 |
| Molecular Formula | C16H18ClN3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-chloro-5-[(3R)-1-[(1S)-1-pyridin-2-ylethyl]pyrrolidin-3-yl]pyridine |
| SMILES | C[C@@H](c1ccccn1)N1CC[C@H](c2ccc(Cl)nc2)C1 |
| InChI | InChI=1S/C16H18ClN3/c1-12(15-4-2-3-8-18-15)20-9-7-14(11-20)13-5-6-16(17)19-10-13/h2-6,8,10,12,14H,7,9,11H2,1H3/t12-,14-/m0/s1 |
| InChIKey | SZLVFAUUWLIGPT-JSGCOSHPSA-N |
| XLogP | 3.68 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|