C12H12ClN3O2 — CID 75432261
N-(4-chloro-2-hydroxyphenyl)-2-(5-methyl-1H-pyrazol-3-yl)acetamide (PubChem CID 75432261) has the molecular formula C12H12ClN3O2 and a molecular weight of 265.70 g/mol. Its IUPAC name is N-(4-chloro-2-hydroxyphenyl)-2-(5-methyl-1H-pyrazol-3-yl)acetamide.
| Compound Name | N-(4-chloro-2-hydroxyphenyl)-2-(5-methyl-1H-pyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 75432261 |
| Molecular Formula | C12H12ClN3O2 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | N-(4-chloro-2-hydroxyphenyl)-2-(5-methyl-1H-pyrazol-3-yl)acetamide |
| SMILES | Cc1cc(CC(=O)Nc2ccc(Cl)cc2O)n[nH]1 |
| InChI | InChI=1S/C12H12ClN3O2/c1-7-4-9(16-15-7)6-12(18)14-10-3-2-8(13)5-11(10)17/h2-5,17H,6H2,1H3,(H,14,18)(H,15,16) |
| InChIKey | HSOLRHZLOOYKFQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|