C19H20ClN3O2 — CID 23008399
2-(2-tert-butylbenzimidazol-1-yl)-N-(4-chloro-2-hydroxyphenyl)acetamide (PubChem CID 23008399) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is 2-(2-tert-butylbenzimidazol-1-yl)-N-(4-chloro-2-hydroxyphenyl)acetamide.
| Compound Name | 2-(2-tert-butylbenzimidazol-1-yl)-N-(4-chloro-2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 23008399 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-(2-tert-butylbenzimidazol-1-yl)-N-(4-chloro-2-hydroxyphenyl)acetamide |
| SMILES | CC(C)(C)c1nc2ccccc2n1CC(=O)Nc1ccc(Cl)cc1O |
| InChI | InChI=1S/C19H20ClN3O2/c1-19(2,3)18-22-13-6-4-5-7-15(13)23(18)11-17(25)21-14-9-8-12(20)10-16(14)24/h4-10,24H,11H2,1-3H3,(H,21,25) |
| InChIKey | XCRSBZCDUXBHGZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|