C17H14ClF2N3OS — CID 26703232
N-(4-chloro-2-methylphenyl)-2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetamide (PubChem CID 26703232) has the molecular formula C17H14ClF2N3OS and a molecular weight of 381.84 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 26703232 |
| Molecular Formula | C17H14ClF2N3OS |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)Cn1c(SC(F)F)nc2ccccc21 |
| InChI | InChI=1S/C17H14ClF2N3OS/c1-10-8-11(18)6-7-12(10)21-15(24)9-23-14-5-3-2-4-13(14)22-17(23)25-16(19)20/h2-8,16H,9H2,1H3,(H,21,24) |
| InChIKey | YVXBJMDKJMWXPU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |