C12H13F2N5O2S — CID 86835783
1-[[2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetyl]amino]-3-methylurea (PubChem CID 86835783) has the molecular formula C12H13F2N5O2S and a molecular weight of 329.33 g/mol. Its IUPAC name is 1-[[2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetyl]amino]-3-methylurea.
| Compound Name | 1-[[2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetyl]amino]-3-methylurea |
|---|---|
| PubChem CID | 86835783 |
| Molecular Formula | C12H13F2N5O2S |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 1-[[2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetyl]amino]-3-methylurea |
| SMILES | CNC(=O)NNC(=O)Cn1c(SC(F)F)nc2ccccc21 |
| InChI | InChI=1S/C12H13F2N5O2S/c1-15-11(21)18-17-9(20)6-19-8-5-3-2-4-7(8)16-12(19)22-10(13)14/h2-5,10H,6H2,1H3,(H,17,20)(H2,15,18,21) |
| InChIKey | HBVVOTLORFLDLO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|