C19H17F3N4O3S — CID 55405766
N'-[2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetyl]-2-(2-fluorophenoxy)propanehydrazide (PubChem CID 55405766) has the molecular formula C19H17F3N4O3S and a molecular weight of 438.43 g/mol. Its IUPAC name is N'-[2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetyl]-2-(2-fluorophenoxy)propanehydrazide.
| Compound Name | N'-[2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetyl]-2-(2-fluorophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 55405766 |
| Molecular Formula | C19H17F3N4O3S |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | N'-[2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetyl]-2-(2-fluorophenoxy)propanehydrazide |
| SMILES | CC(Oc1ccccc1F)C(=O)NNC(=O)Cn1c(SC(F)F)nc2ccccc21 |
| InChI | InChI=1S/C19H17F3N4O3S/c1-11(29-15-9-5-2-6-12(15)20)17(28)25-24-16(27)10-26-14-8-4-3-7-13(14)23-19(26)30-18(21)22/h2-9,11,18H,10H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | ULLWHDQTXNASFJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|