C21H17F2N5O2S2 — CID 26311908
N'-[2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide (PubChem CID 26311908) has the molecular formula C21H17F2N5O2S2 and a molecular weight of 473.53 g/mol. Its IUPAC name is N'-[2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-[2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 26311908 |
| Molecular Formula | C21H17F2N5O2S2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | N'-[2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]acetyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)NNC(=O)Cn1c(SC(F)F)nc2ccccc21 |
| InChI | InChI=1S/C21H17F2N5O2S2/c1-12-17(31-19(24-12)13-7-3-2-4-8-13)18(30)27-26-16(29)11-28-15-10-6-5-9-14(15)25-21(28)32-20(22)23/h2-10,20H,11H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | GCNVPYODNXZGML-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|