C20H15F2N5OS — CID 134009523
2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]-N-(2-phenylpyrimidin-5-yl)acetamide (PubChem CID 134009523) has the molecular formula C20H15F2N5OS and a molecular weight of 411.44 g/mol. Its IUPAC name is 2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]-N-(2-phenylpyrimidin-5-yl)acetamide.
| Compound Name | 2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]-N-(2-phenylpyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 134009523 |
| Molecular Formula | C20H15F2N5OS |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]-N-(2-phenylpyrimidin-5-yl)acetamide |
| SMILES | O=C(Cn1c(SC(F)F)nc2ccccc21)Nc1cnc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C20H15F2N5OS/c21-19(22)29-20-26-15-8-4-5-9-16(15)27(20)12-17(28)25-14-10-23-18(24-11-14)13-6-2-1-3-7-13/h1-11,19H,12H2,(H,25,28) |
| InChIKey | JUTYQEUTDZEHNK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |